C25H30N+ — CID 159478034
1-(5-cyclohexyl-2-methylphenyl)-4-deuterio-2,3,6-trimethylisoquinolin-2-ium (PubChem CID 159478034) has the molecular formula C25H30N+ and a molecular weight of 345.53 g/mol. Its IUPAC name is 1-(5-cyclohexyl-2-methylphenyl)-4-deuterio-2,3,6-trimethylisoquinolin-2-ium.
| Compound Name | 1-(5-cyclohexyl-2-methylphenyl)-4-deuterio-2,3,6-trimethylisoquinolin-2-ium |
|---|---|
| PubChem CID | 159478034 |
| Molecular Formula | C25H30N+ |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | 1-(5-cyclohexyl-2-methylphenyl)-4-deuterio-2,3,6-trimethylisoquinolin-2-ium |
| SMILES | [2H]c1c(C)[n+](C)c(-c2cc(C3CCCCC3)ccc2C)c2ccc(C)cc12 |
| InChI | InChI=1S/C25H30N/c1-17-10-13-23-22(14-17)15-19(3)26(4)25(23)24-16-21(12-11-18(24)2)20-8-6-5-7-9-20/h10-16,20H,5-9H2,1-4H3/q+1/i15D |
| InChIKey | RVOJORUORYTKNP-RWFJLFJASA-N |
| XLogP | 6.30 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|