C30H38N+ — CID 159932991
1-(5-cyclohexyl-2-methylphenyl)-6-(cyclopentylmethyl)-4-deuterio-2,3-dimethylisoquinolin-2-ium (PubChem CID 159932991) has the molecular formula C30H38N+ and a molecular weight of 413.65 g/mol. Its IUPAC name is 1-(5-cyclohexyl-2-methylphenyl)-6-(cyclopentylmethyl)-4-deuterio-2,3-dimethylisoquinolin-2-ium.
| Compound Name | 1-(5-cyclohexyl-2-methylphenyl)-6-(cyclopentylmethyl)-4-deuterio-2,3-dimethylisoquinolin-2-ium |
|---|---|
| PubChem CID | 159932991 |
| Molecular Formula | C30H38N+ |
| Molecular Weight | 413.65 g/mol |
| Exact Mass | 413.31 |
| IUPAC Name | 1-(5-cyclohexyl-2-methylphenyl)-6-(cyclopentylmethyl)-4-deuterio-2,3-dimethylisoquinolin-2-ium |
| SMILES | [2H]c1c(C)[n+](C)c(-c2cc(C3CCCCC3)ccc2C)c2ccc(CC3CCCC3)cc12 |
| InChI | InChI=1S/C30H38N/c1-21-13-15-26(25-11-5-4-6-12-25)20-29(21)30-28-16-14-24(18-23-9-7-8-10-23)19-27(28)17-22(2)31(30)3/h13-17,19-20,23,25H,4-12,18H2,1-3H3/q+1/i17D |
| InChIKey | VYBZWMNTQVTAHO-OKWSDYJOSA-N |
| XLogP | 7.73 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.65 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|