C31H42NSi+ — CID 157290080
1-(5-cyclohexyl-2-methylphenyl)-4-deuterio-6-(1,1-dimethylsilinan-4-yl)-2,3-dimethylisoquinolin-2-ium (PubChem CID 157290080) has the molecular formula C31H42NSi+ and a molecular weight of 457.78 g/mol. Its IUPAC name is 1-(5-cyclohexyl-2-methylphenyl)-4-deuterio-6-(1,1-dimethylsilinan-4-yl)-2,3-dimethylisoquinolin-2-ium.
| Compound Name | 1-(5-cyclohexyl-2-methylphenyl)-4-deuterio-6-(1,1-dimethylsilinan-4-yl)-2,3-dimethylisoquinolin-2-ium |
|---|---|
| PubChem CID | 157290080 |
| Molecular Formula | C31H42NSi+ |
| Molecular Weight | 457.78 g/mol |
| Exact Mass | 457.31 |
| IUPAC Name | 1-(5-cyclohexyl-2-methylphenyl)-4-deuterio-6-(1,1-dimethylsilinan-4-yl)-2,3-dimethylisoquinolin-2-ium |
| SMILES | [2H]c1c(C)[n+](C)c(-c2cc(C3CCCCC3)ccc2C)c2ccc(C3CC[Si](C)(C)CC3)cc12 |
| InChI | InChI=1S/C31H42NSi/c1-22-11-12-27(24-9-7-6-8-10-24)21-30(22)31-29-14-13-26(20-28(29)19-23(2)32(31)3)25-15-17-33(4,5)18-16-25/h11-14,19-21,24-25H,6-10,15-18H2,1-5H3/q+1/i19D |
| InChIKey | PTEIVBUKZUDNCL-YUIGOLOMSA-N |
| XLogP | 8.58 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.78 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|