C33H42N+ — CID 155639357
6-(cyclopentylmethyl)-3-deuterio-1-(3,5-dicyclopentyl-2-methylphenyl)-2-methylisoquinolin-2-ium (PubChem CID 155639357) has the molecular formula C33H42N+ and a molecular weight of 453.71 g/mol. Its IUPAC name is 6-(cyclopentylmethyl)-3-deuterio-1-(3,5-dicyclopentyl-2-methylphenyl)-2-methylisoquinolin-2-ium.
| Compound Name | 6-(cyclopentylmethyl)-3-deuterio-1-(3,5-dicyclopentyl-2-methylphenyl)-2-methylisoquinolin-2-ium |
|---|---|
| PubChem CID | 155639357 |
| Molecular Formula | C33H42N+ |
| Molecular Weight | 453.71 g/mol |
| Exact Mass | 453.34 |
| IUPAC Name | 6-(cyclopentylmethyl)-3-deuterio-1-(3,5-dicyclopentyl-2-methylphenyl)-2-methylisoquinolin-2-ium |
| SMILES | [2H]c1cc2cc(CC3CCCC3)ccc2c(-c2cc(C3CCCC3)cc(C3CCCC3)c2C)[n+]1C |
| InChI | InChI=1S/C33H42N/c1-23-31(27-13-7-8-14-27)21-29(26-11-5-6-12-26)22-32(23)33-30-16-15-25(19-24-9-3-4-10-24)20-28(30)17-18-34(33)2/h15-18,20-22,24,26-27H,3-14,19H2,1-2H3/q+1/i18D |
| InChIKey | AFHZRVHLSYOULP-VAAKKRCDSA-N |
| XLogP | 8.69 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.71 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|