C23H28N+ — CID 161447353
4-deuterio-1-(3,5-diethyl-2-methylphenyl)-2,3,6-trimethylisoquinolin-2-ium (PubChem CID 161447353) has the molecular formula C23H28N+ and a molecular weight of 319.49 g/mol. Its IUPAC name is 4-deuterio-1-(3,5-diethyl-2-methylphenyl)-2,3,6-trimethylisoquinolin-2-ium.
| Compound Name | 4-deuterio-1-(3,5-diethyl-2-methylphenyl)-2,3,6-trimethylisoquinolin-2-ium |
|---|---|
| PubChem CID | 161447353 |
| Molecular Formula | C23H28N+ |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | 4-deuterio-1-(3,5-diethyl-2-methylphenyl)-2,3,6-trimethylisoquinolin-2-ium |
| SMILES | [2H]c1c(C)[n+](C)c(-c2cc(CC)cc(CC)c2C)c2ccc(C)cc12 |
| InChI | InChI=1S/C23H28N/c1-7-18-13-19(8-2)17(5)22(14-18)23-21-10-9-15(3)11-20(21)12-16(4)24(23)6/h9-14H,7-8H2,1-6H3/q+1/i12D |
| InChIKey | XHHUUEUHICUEJZ-UQBWLURTSA-N |
| XLogP | 5.38 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|