C27H36N+ — CID 162030564
1-(3,5-diethyl-2-methylphenyl)-6-(2,2-dimethylpropyl)-2,3-dimethylisoquinolin-2-ium (PubChem CID 162030564) has the molecular formula C27H36N+ and a molecular weight of 374.59 g/mol. Its IUPAC name is 1-(3,5-diethyl-2-methylphenyl)-6-(2,2-dimethylpropyl)-2,3-dimethylisoquinolin-2-ium.
| Compound Name | 1-(3,5-diethyl-2-methylphenyl)-6-(2,2-dimethylpropyl)-2,3-dimethylisoquinolin-2-ium |
|---|---|
| PubChem CID | 162030564 |
| Molecular Formula | C27H36N+ |
| Molecular Weight | 374.59 g/mol |
| Exact Mass | 374.28 |
| IUPAC Name | 1-(3,5-diethyl-2-methylphenyl)-6-(2,2-dimethylpropyl)-2,3-dimethylisoquinolin-2-ium |
| SMILES | CCc1cc(CC)c(C)c(-c2c3ccc(CC(C)(C)C)cc3cc(C)[n+]2C)c1 |
| InChI | InChI=1S/C27H36N/c1-9-20-14-22(10-2)19(4)25(16-20)26-24-12-11-21(17-27(5,6)7)15-23(24)13-18(3)28(26)8/h11-16H,9-10,17H2,1-8H3/q+1 |
| InChIKey | ITJJPZDJIHIPID-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.59 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|