C20H28 — CID 147176407
2,7-bis(2,2-dimethylpropyl)naphthalene (PubChem CID 147176407) has the molecular formula C20H28 and a molecular weight of 268.44 g/mol. Its IUPAC name is 2,7-bis(2,2-dimethylpropyl)naphthalene.
| Compound Name | 2,7-bis(2,2-dimethylpropyl)naphthalene |
|---|---|
| PubChem CID | 147176407 |
| Molecular Formula | C20H28 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | 2,7-bis(2,2-dimethylpropyl)naphthalene |
| SMILES | CC(C)(C)Cc1ccc2ccc(CC(C)(C)C)cc2c1 |
| InChI | InChI=1S/C20H28/c1-19(2,3)13-15-7-9-17-10-8-16(12-18(17)11-15)14-20(4,5)6/h7-12H,13-14H2,1-6H3 |
| InChIKey | BYSRELOIKTTXFA-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |