C23H27FN+ — CID 158952542
1-(5-tert-butyl-2,3-dimethylphenyl)-6-fluoro-2,3-dimethylisoquinolin-2-ium (PubChem CID 158952542) has the molecular formula C23H27FN+ and a molecular weight of 336.47 g/mol. Its IUPAC name is 1-(5-tert-butyl-2,3-dimethylphenyl)-6-fluoro-2,3-dimethylisoquinolin-2-ium.
| Compound Name | 1-(5-tert-butyl-2,3-dimethylphenyl)-6-fluoro-2,3-dimethylisoquinolin-2-ium |
|---|---|
| PubChem CID | 158952542 |
| Molecular Formula | C23H27FN+ |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | 1-(5-tert-butyl-2,3-dimethylphenyl)-6-fluoro-2,3-dimethylisoquinolin-2-ium |
| SMILES | Cc1cc(C(C)(C)C)cc(-c2c3ccc(F)cc3cc(C)[n+]2C)c1C |
| InChI | InChI=1S/C23H27FN/c1-14-10-18(23(4,5)6)13-21(16(14)3)22-20-9-8-19(24)12-17(20)11-15(2)25(22)7/h8-13H,1-7H3/q+1 |
| InChIKey | NZHFLWUYNMIDBA-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|