C23H28N+ — CID 159986315
1-(5-tert-butyl-2-methylphenyl)-2,3,7-trimethylisoquinolin-2-ium (PubChem CID 159986315) has the molecular formula C23H28N+ and a molecular weight of 318.48 g/mol. Its IUPAC name is 1-(5-tert-butyl-2-methylphenyl)-2,3,7-trimethylisoquinolin-2-ium.
| Compound Name | 1-(5-tert-butyl-2-methylphenyl)-2,3,7-trimethylisoquinolin-2-ium |
|---|---|
| PubChem CID | 159986315 |
| Molecular Formula | C23H28N+ |
| Molecular Weight | 318.48 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | 1-(5-tert-butyl-2-methylphenyl)-2,3,7-trimethylisoquinolin-2-ium |
| SMILES | Cc1ccc2cc(C)[n+](C)c(-c3cc(C(C)(C)C)ccc3C)c2c1 |
| InChI | InChI=1S/C23H28N/c1-15-8-10-18-13-17(3)24(7)22(21(18)12-15)20-14-19(23(4,5)6)11-9-16(20)2/h8-14H,1-7H3/q+1 |
| InChIKey | PBUCENVGXRPSTI-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.48 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|