C22H26N+ — CID 160809135
6-tert-butyl-1-(3,5-dideuterio-2-methylphenyl)-2,3-dimethylisoquinolin-2-ium (PubChem CID 160809135) has the molecular formula C22H26N+ and a molecular weight of 306.47 g/mol. Its IUPAC name is 6-tert-butyl-1-(3,5-dideuterio-2-methylphenyl)-2,3-dimethylisoquinolin-2-ium.
| Compound Name | 6-tert-butyl-1-(3,5-dideuterio-2-methylphenyl)-2,3-dimethylisoquinolin-2-ium |
|---|---|
| PubChem CID | 160809135 |
| Molecular Formula | C22H26N+ |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | 6-tert-butyl-1-(3,5-dideuterio-2-methylphenyl)-2,3-dimethylisoquinolin-2-ium |
| SMILES | [2H]c1cc([2H])c(C)c(-c2c3ccc(C(C)(C)C)cc3cc(C)[n+]2C)c1 |
| InChI | InChI=1S/C22H26N/c1-15-9-7-8-10-19(15)21-20-12-11-18(22(3,4)5)14-17(20)13-16(2)23(21)6/h7-14H,1-6H3/q+1/i8D,9D |
| InChIKey | UKEUOOULJFRJOV-XETGXLELSA-N |
| XLogP | 5.25 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|