C19H17N2+ — CID 159918149
1-(3,5-dideuterio-2-methylphenyl)-6-isocyano-2,3-dimethylisoquinolin-2-ium (PubChem CID 159918149) has the molecular formula C19H17N2+ and a molecular weight of 275.37 g/mol. Its IUPAC name is 1-(3,5-dideuterio-2-methylphenyl)-6-isocyano-2,3-dimethylisoquinolin-2-ium.
| Compound Name | 1-(3,5-dideuterio-2-methylphenyl)-6-isocyano-2,3-dimethylisoquinolin-2-ium |
|---|---|
| PubChem CID | 159918149 |
| Molecular Formula | C19H17N2+ |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 1-(3,5-dideuterio-2-methylphenyl)-6-isocyano-2,3-dimethylisoquinolin-2-ium |
| SMILES | [2H]c1cc([2H])c(C)c(-c2c3ccc([N+]#[C-])cc3cc(C)[n+]2C)c1 |
| InChI | InChI=1S/C19H17N2/c1-13-7-5-6-8-17(13)19-18-10-9-16(20-3)12-15(18)11-14(2)21(19)4/h5-12H,1-2,4H3/q+1/i6D,7D |
| InChIKey | MPOBPYTXYFZKSI-QFIQSOQBSA-N |
| XLogP | 4.50 |
| TPSA | 8.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|