C20H19N2+ — CID 155639182
6-isocyano-2-methyl-1-[2-methyl-3,5-bis(trideuteriomethyl)phenyl]isoquinolin-2-ium (PubChem CID 155639182) has the molecular formula C20H19N2+ and a molecular weight of 293.42 g/mol. Its IUPAC name is 6-isocyano-2-methyl-1-[2-methyl-3,5-bis(trideuteriomethyl)phenyl]isoquinolin-2-ium.
| Compound Name | 6-isocyano-2-methyl-1-[2-methyl-3,5-bis(trideuteriomethyl)phenyl]isoquinolin-2-ium |
|---|---|
| PubChem CID | 155639182 |
| Molecular Formula | C20H19N2+ |
| Molecular Weight | 293.42 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | 6-isocyano-2-methyl-1-[2-methyl-3,5-bis(trideuteriomethyl)phenyl]isoquinolin-2-ium |
| SMILES | [2H]C([2H])([2H])c1cc(-c2c3ccc([N+]#[C-])cc3cc[n+]2C)c(C)c(C([2H])([2H])[2H])c1 |
| InChI | InChI=1S/C20H19N2/c1-13-10-14(2)15(3)19(11-13)20-18-7-6-17(21-4)12-16(18)8-9-22(20)5/h6-12H,1-3,5H3/q+1/i1D3,2D3 |
| InChIKey | UKVVZXQGIXGZJO-WFGJKAKNSA-N |
| XLogP | 4.81 |
| TPSA | 8.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.42 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|