C23H22N3+ — CID 166054833
2-isocyano-2-[2-methyl-1-(2,3,5-trimethylphenyl)isoquinolin-2-ium-6-yl]propanenitrile (PubChem CID 166054833) has the molecular formula C23H22N3+ and a molecular weight of 340.45 g/mol. Its IUPAC name is 2-isocyano-2-[2-methyl-1-(2,3,5-trimethylphenyl)isoquinolin-2-ium-6-yl]propanenitrile.
| Compound Name | 2-isocyano-2-[2-methyl-1-(2,3,5-trimethylphenyl)isoquinolin-2-ium-6-yl]propanenitrile |
|---|---|
| PubChem CID | 166054833 |
| Molecular Formula | C23H22N3+ |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 2-isocyano-2-[2-methyl-1-(2,3,5-trimethylphenyl)isoquinolin-2-ium-6-yl]propanenitrile |
| SMILES | [C-]#[N+]C(C)(C#N)c1ccc2c(-c3cc(C)cc(C)c3C)[n+](C)ccc2c1 |
| InChI | InChI=1S/C23H22N3/c1-15-11-16(2)17(3)21(12-15)22-20-8-7-19(23(4,14-24)25-5)13-18(20)9-10-26(22)6/h7-13H,1-4,6H3/q+1 |
| InChIKey | MEGNGZXCXAVUEW-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 32.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|