C24H27N2+ — CID 161389763
3,4-dideuterio-6-isocyano-2-methyl-1-[2-methyl-3,5-di(propan-2-yl)phenyl]isoquinolin-2-ium (PubChem CID 161389763) has the molecular formula C24H27N2+ and a molecular weight of 345.51 g/mol. Its IUPAC name is 3,4-dideuterio-6-isocyano-2-methyl-1-[2-methyl-3,5-di(propan-2-yl)phenyl]isoquinolin-2-ium.
| Compound Name | 3,4-dideuterio-6-isocyano-2-methyl-1-[2-methyl-3,5-di(propan-2-yl)phenyl]isoquinolin-2-ium |
|---|---|
| PubChem CID | 161389763 |
| Molecular Formula | C24H27N2+ |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | 3,4-dideuterio-6-isocyano-2-methyl-1-[2-methyl-3,5-di(propan-2-yl)phenyl]isoquinolin-2-ium |
| SMILES | [2H]c1c([2H])[n+](C)c(-c2cc(C(C)C)cc(C(C)C)c2C)c2ccc([N+]#[C-])cc12 |
| InChI | InChI=1S/C24H27N2/c1-15(2)19-13-22(16(3)4)17(5)23(14-19)24-21-9-8-20(25-6)12-18(21)10-11-26(24)7/h8-16H,1-5,7H3/q+1/i10D,11D |
| InChIKey | DGJIQNZKKLXDAY-MIBQVNFTSA-N |
| XLogP | 6.44 |
| TPSA | 8.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|