C24H32NSi+ — CID 159827721
[3,4-dideuterio-1-[2,3-dimethyl-5-(1,1,1,2-tetradeuteriopropan-2-yl)phenyl]-2-methylisoquinolin-2-ium-6-yl]-trimethylsilane (PubChem CID 159827721) has the molecular formula C24H32NSi+ and a molecular weight of 368.65 g/mol. Its IUPAC name is [3,4-dideuterio-1-[2,3-dimethyl-5-(1,1,1,2-tetradeuteriopropan-2-yl)phenyl]-2-methylisoquinolin-2-ium-6-yl]-trimethylsilane.
| Compound Name | [3,4-dideuterio-1-[2,3-dimethyl-5-(1,1,1,2-tetradeuteriopropan-2-yl)phenyl]-2-methylisoquinolin-2-ium-6-yl]-trimethylsilane |
|---|---|
| PubChem CID | 159827721 |
| Molecular Formula | C24H32NSi+ |
| Molecular Weight | 368.65 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | [3,4-dideuterio-1-[2,3-dimethyl-5-(1,1,1,2-tetradeuteriopropan-2-yl)phenyl]-2-methylisoquinolin-2-ium-6-yl]-trimethylsilane |
| SMILES | [2H]c1c([2H])[n+](C)c(-c2cc(C([2H])(C)C([2H])([2H])[2H])cc(C)c2C)c2ccc([Si](C)(C)C)cc12 |
| InChI | InChI=1S/C24H32NSi/c1-16(2)20-13-17(3)18(4)23(15-20)24-22-10-9-21(26(6,7)8)14-19(22)11-12-25(24)5/h9-16H,1-8H3/q+1/i1D3,11D,12D,16D |
| InChIKey | KJWPPVYVERSKDR-KWKBSFLCSA-N |
| XLogP | 5.62 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.65 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|