C27H36N+ — CID 159986211
6-butan-2-yl-3,4-dideuterio-2-methyl-1-[2-methyl-3,5-di(propan-2-yl)phenyl]isoquinolin-2-ium (PubChem CID 159986211) has the molecular formula C27H36N+ and a molecular weight of 376.60 g/mol. Its IUPAC name is 6-butan-2-yl-3,4-dideuterio-2-methyl-1-[2-methyl-3,5-di(propan-2-yl)phenyl]isoquinolin-2-ium.
| Compound Name | 6-butan-2-yl-3,4-dideuterio-2-methyl-1-[2-methyl-3,5-di(propan-2-yl)phenyl]isoquinolin-2-ium |
|---|---|
| PubChem CID | 159986211 |
| Molecular Formula | C27H36N+ |
| Molecular Weight | 376.60 g/mol |
| Exact Mass | 376.30 |
| IUPAC Name | 6-butan-2-yl-3,4-dideuterio-2-methyl-1-[2-methyl-3,5-di(propan-2-yl)phenyl]isoquinolin-2-ium |
| SMILES | [2H]c1c([2H])[n+](C)c(-c2cc(C(C)C)cc(C(C)C)c2C)c2ccc(C(C)CC)cc12 |
| InChI | InChI=1S/C27H36N/c1-9-19(6)21-10-11-24-22(14-21)12-13-28(8)27(24)26-16-23(17(2)3)15-25(18(4)5)20(26)7/h10-19H,9H2,1-8H3/q+1/i12D,13D |
| InChIKey | JELPIWWWXJWJSA-LNBFZYQFSA-N |
| XLogP | 7.40 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.60 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|