C31H42N+ — CID 155639275
3-deuterio-6-(4,4-dimethylcyclohexyl)-2-methyl-1-[2-methyl-3,5-di(propan-2-yl)phenyl]isoquinolin-2-ium (PubChem CID 155639275) has the molecular formula C31H42N+ and a molecular weight of 429.69 g/mol. Its IUPAC name is 3-deuterio-6-(4,4-dimethylcyclohexyl)-2-methyl-1-[2-methyl-3,5-di(propan-2-yl)phenyl]isoquinolin-2-ium.
| Compound Name | 3-deuterio-6-(4,4-dimethylcyclohexyl)-2-methyl-1-[2-methyl-3,5-di(propan-2-yl)phenyl]isoquinolin-2-ium |
|---|---|
| PubChem CID | 155639275 |
| Molecular Formula | C31H42N+ |
| Molecular Weight | 429.69 g/mol |
| Exact Mass | 429.34 |
| IUPAC Name | 3-deuterio-6-(4,4-dimethylcyclohexyl)-2-methyl-1-[2-methyl-3,5-di(propan-2-yl)phenyl]isoquinolin-2-ium |
| SMILES | [2H]c1cc2cc(C3CCC(C)(C)CC3)ccc2c(-c2cc(C(C)C)cc(C(C)C)c2C)[n+]1C |
| InChI | InChI=1S/C31H42N/c1-20(2)26-18-28(21(3)4)22(5)29(19-26)30-27-10-9-24(17-25(27)13-16-32(30)8)23-11-14-31(6,7)15-12-23/h9-10,13,16-21,23H,11-12,14-15H2,1-8H3/q+1/i16D |
| InChIKey | UBTLPRCRYVSMPU-QNLPYAOMSA-N |
| XLogP | 8.57 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.69 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|