C27H33FN+ — CID 155638963
6-(4,4-dimethylcyclohexyl)-1-(4-fluoro-2,3,5-trimethylphenyl)-2-methylisoquinolin-2-ium (PubChem CID 155638963) has the molecular formula C27H33FN+ and a molecular weight of 390.57 g/mol. Its IUPAC name is 6-(4,4-dimethylcyclohexyl)-1-(4-fluoro-2,3,5-trimethylphenyl)-2-methylisoquinolin-2-ium.
| Compound Name | 6-(4,4-dimethylcyclohexyl)-1-(4-fluoro-2,3,5-trimethylphenyl)-2-methylisoquinolin-2-ium |
|---|---|
| PubChem CID | 155638963 |
| Molecular Formula | C27H33FN+ |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | 6-(4,4-dimethylcyclohexyl)-1-(4-fluoro-2,3,5-trimethylphenyl)-2-methylisoquinolin-2-ium |
| SMILES | Cc1cc(-c2c3ccc(C4CCC(C)(C)CC4)cc3cc[n+]2C)c(C)c(C)c1F |
| InChI | InChI=1S/C27H33FN/c1-17-15-24(18(2)19(3)25(17)28)26-23-8-7-21(16-22(23)11-14-29(26)6)20-9-12-27(4,5)13-10-20/h7-8,11,14-16,20H,9-10,12-13H2,1-6H3/q+1 |
| InChIKey | JKGLNBPRPJOPAL-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|