C21H24N+ — CID 157391331
1-[3-(1,1-dideuterioethyl)-2-methyl-5-(trideuteriomethyl)phenyl]-2,6-dimethylisoquinolin-2-ium (PubChem CID 157391331) has the molecular formula C21H24N+ and a molecular weight of 295.46 g/mol. Its IUPAC name is 1-[3-(1,1-dideuterioethyl)-2-methyl-5-(trideuteriomethyl)phenyl]-2,6-dimethylisoquinolin-2-ium.
| Compound Name | 1-[3-(1,1-dideuterioethyl)-2-methyl-5-(trideuteriomethyl)phenyl]-2,6-dimethylisoquinolin-2-ium |
|---|---|
| PubChem CID | 157391331 |
| Molecular Formula | C21H24N+ |
| Molecular Weight | 295.46 g/mol |
| Exact Mass | 295.22 |
| IUPAC Name | 1-[3-(1,1-dideuterioethyl)-2-methyl-5-(trideuteriomethyl)phenyl]-2,6-dimethylisoquinolin-2-ium |
| SMILES | [2H]C([2H])([2H])c1cc(-c2c3ccc(C)cc3cc[n+]2C)c(C)c(C([2H])([2H])C)c1 |
| InChI | InChI=1S/C21H24N/c1-6-17-12-15(3)13-20(16(17)4)21-19-8-7-14(2)11-18(19)9-10-22(21)5/h7-13H,6H2,1-5H3/q+1/i3D3,6D2 |
| InChIKey | ILANZCPCYAMDEH-SBRIIUNQSA-N |
| XLogP | 4.82 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.46 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|