C25H29N2Si+ — CID 155637874
1-(5-isocyano-2,3-dimethylphenyl)-2-methyl-6-(1-methylsilinan-1-yl)isoquinolin-2-ium (PubChem CID 155637874) has the molecular formula C25H29N2Si+ and a molecular weight of 385.61 g/mol. Its IUPAC name is 1-(5-isocyano-2,3-dimethylphenyl)-2-methyl-6-(1-methylsilinan-1-yl)isoquinolin-2-ium.
| Compound Name | 1-(5-isocyano-2,3-dimethylphenyl)-2-methyl-6-(1-methylsilinan-1-yl)isoquinolin-2-ium |
|---|---|
| PubChem CID | 155637874 |
| Molecular Formula | C25H29N2Si+ |
| Molecular Weight | 385.61 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | 1-(5-isocyano-2,3-dimethylphenyl)-2-methyl-6-(1-methylsilinan-1-yl)isoquinolin-2-ium |
| SMILES | [C-]#[N+]c1cc(C)c(C)c(-c2c3ccc([Si]4(C)CCCCC4)cc3cc[n+]2C)c1 |
| InChI | InChI=1S/C25H29N2Si/c1-18-15-21(26-3)17-24(19(18)2)25-23-10-9-22(16-20(23)11-12-27(25)4)28(5)13-7-6-8-14-28/h9-12,15-17H,6-8,13-14H2,1-2,4-5H3/q+1 |
| InChIKey | KPVARXBNOOFRRP-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 8.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.61 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|