C42H34N+ — CID 157061922
6-(14-hexacyclo[9.6.6.02,10.04,8.012,17.018,23]tricosa-2,4,7,9,12(17),13,15,18,20,22-decaenyl)-2-methyl-1-(2,3,5-trimethylphenyl)isoquinolin-2-ium (PubChem CID 157061922) has the molecular formula C42H34N+ and a molecular weight of 552.74 g/mol. Its IUPAC name is 6-(14-hexacyclo[9.6.6.02,10.04,8.012,17.018,23]tricosa-2,4,7,9,12(17),13,15,18,20,22-decaenyl)-2-methyl-1-(2,3,5-trimethylphenyl)isoquinolin-2-ium.
| Compound Name | 6-(14-hexacyclo[9.6.6.02,10.04,8.012,17.018,23]tricosa-2,4,7,9,12(17),13,15,18,20,22-decaenyl)-2-methyl-1-(2,3,5-trimethylphenyl)isoquinolin-2-ium |
|---|---|
| PubChem CID | 157061922 |
| Molecular Formula | C42H34N+ |
| Molecular Weight | 552.74 g/mol |
| Exact Mass | 552.27 |
| IUPAC Name | 6-(14-hexacyclo[9.6.6.02,10.04,8.012,17.018,23]tricosa-2,4,7,9,12(17),13,15,18,20,22-decaenyl)-2-methyl-1-(2,3,5-trimethylphenyl)isoquinolin-2-ium |
| SMILES | Cc1cc(C)c(C)c(-c2c3ccc(-c4ccc5c(c4)C4c6ccccc6C5c5cc6c(cc54)=CCC=6)cc3cc[n+]2C)c1 |
| InChI | InChI=1S/C42H34N/c1-24-18-25(2)26(3)36(19-24)42-32-14-12-29(20-31(32)16-17-43(42)4)30-13-15-35-37(23-30)41-34-11-6-5-10-33(34)40(35)38-21-27-8-7-9-28(27)22-39(38)41/h5-6,8-23,40-41H,7H2,1-4H3/q+1 |
| InChIKey | IPTNAJGZIBBNMA-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.74 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|