C25H23FN+ — CID 155638774
1-(2-fluoro-3,5,6-trimethylphenyl)-2-methyl-6-phenylisoquinolin-2-ium (PubChem CID 155638774) has the molecular formula C25H23FN+ and a molecular weight of 356.46 g/mol. Its IUPAC name is 1-(2-fluoro-3,5,6-trimethylphenyl)-2-methyl-6-phenylisoquinolin-2-ium.
| Compound Name | 1-(2-fluoro-3,5,6-trimethylphenyl)-2-methyl-6-phenylisoquinolin-2-ium |
|---|---|
| PubChem CID | 155638774 |
| Molecular Formula | C25H23FN+ |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 1-(2-fluoro-3,5,6-trimethylphenyl)-2-methyl-6-phenylisoquinolin-2-ium |
| SMILES | Cc1cc(C)c(F)c(-c2c3ccc(-c4ccccc4)cc3cc[n+]2C)c1C |
| InChI | InChI=1S/C25H23FN/c1-16-14-17(2)24(26)23(18(16)3)25-22-11-10-20(19-8-6-5-7-9-19)15-21(22)12-13-27(25)4/h5-15H,1-4H3/q+1 |
| InChIKey | VGTOYVZUWDEQRG-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|