C28H30N+ — CID 155639193
6-(2,2-dimethylpropyl)-2-methyl-1-(2-methyl-4-phenylphenyl)isoquinolin-2-ium (PubChem CID 155639193) has the molecular formula C28H30N+ and a molecular weight of 380.56 g/mol. Its IUPAC name is 6-(2,2-dimethylpropyl)-2-methyl-1-(2-methyl-4-phenylphenyl)isoquinolin-2-ium.
| Compound Name | 6-(2,2-dimethylpropyl)-2-methyl-1-(2-methyl-4-phenylphenyl)isoquinolin-2-ium |
|---|---|
| PubChem CID | 155639193 |
| Molecular Formula | C28H30N+ |
| Molecular Weight | 380.56 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | 6-(2,2-dimethylpropyl)-2-methyl-1-(2-methyl-4-phenylphenyl)isoquinolin-2-ium |
| SMILES | Cc1cc(-c2ccccc2)ccc1-c1c2ccc(CC(C)(C)C)cc2cc[n+]1C |
| InChI | InChI=1S/C28H30N/c1-20-17-23(22-9-7-6-8-10-22)12-14-25(20)27-26-13-11-21(19-28(2,3)4)18-24(26)15-16-29(27)5/h6-18H,19H2,1-5H3/q+1 |
| InChIKey | XCPLTCQVUASPHL-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.56 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|