C31H38NSi+ — CID 155637731
[1-[4-(2,6-dimethylphenyl)-2-methylphenyl]-2-methylisoquinolin-2-ium-6-yl]-triethylsilane (PubChem CID 155637731) has the molecular formula C31H38NSi+ and a molecular weight of 452.74 g/mol. Its IUPAC name is [1-[4-(2,6-dimethylphenyl)-2-methylphenyl]-2-methylisoquinolin-2-ium-6-yl]-triethylsilane.
| Compound Name | [1-[4-(2,6-dimethylphenyl)-2-methylphenyl]-2-methylisoquinolin-2-ium-6-yl]-triethylsilane |
|---|---|
| PubChem CID | 155637731 |
| Molecular Formula | C31H38NSi+ |
| Molecular Weight | 452.74 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | [1-[4-(2,6-dimethylphenyl)-2-methylphenyl]-2-methylisoquinolin-2-ium-6-yl]-triethylsilane |
| SMILES | CC[Si](CC)(CC)c1ccc2c(-c3ccc(-c4c(C)cccc4C)cc3C)[n+](C)ccc2c1 |
| InChI | InChI=1S/C31H38NSi/c1-8-33(9-2,10-3)27-15-17-29-25(21-27)18-19-32(7)31(29)28-16-14-26(20-24(28)6)30-22(4)12-11-13-23(30)5/h11-21H,8-10H2,1-7H3/q+1 |
| InChIKey | CERXXJRHFNIPDV-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.74 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|