C27H35FNSi+ — CID 155637994
cyclohexyl-[1-(2-fluoro-3,5,6-trimethylphenyl)-2-methylisoquinolin-2-ium-6-yl]-dimethylsilane (PubChem CID 155637994) has the molecular formula C27H35FNSi+ and a molecular weight of 420.67 g/mol. Its IUPAC name is cyclohexyl-[1-(2-fluoro-3,5,6-trimethylphenyl)-2-methylisoquinolin-2-ium-6-yl]-dimethylsilane.
| Compound Name | cyclohexyl-[1-(2-fluoro-3,5,6-trimethylphenyl)-2-methylisoquinolin-2-ium-6-yl]-dimethylsilane |
|---|---|
| PubChem CID | 155637994 |
| Molecular Formula | C27H35FNSi+ |
| Molecular Weight | 420.67 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | cyclohexyl-[1-(2-fluoro-3,5,6-trimethylphenyl)-2-methylisoquinolin-2-ium-6-yl]-dimethylsilane |
| SMILES | Cc1cc(C)c(F)c(-c2c3ccc([Si](C)(C)C4CCCCC4)cc3cc[n+]2C)c1C |
| InChI | InChI=1S/C27H35FNSi/c1-18-16-19(2)26(28)25(20(18)3)27-24-13-12-23(17-21(24)14-15-29(27)4)30(5,6)22-10-8-7-9-11-22/h12-17,22H,7-11H2,1-6H3/q+1 |
| InChIKey | KYFOTBTWFNPUDD-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.67 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|