C28H30NSi+ — CID 155638266
2-methyl-1-(2-methyl-5-phenylphenyl)-6-(1-methylsilolan-1-yl)isoquinolin-2-ium (PubChem CID 155638266) has the molecular formula C28H30NSi+ and a molecular weight of 408.64 g/mol. Its IUPAC name is 2-methyl-1-(2-methyl-5-phenylphenyl)-6-(1-methylsilolan-1-yl)isoquinolin-2-ium.
| Compound Name | 2-methyl-1-(2-methyl-5-phenylphenyl)-6-(1-methylsilolan-1-yl)isoquinolin-2-ium |
|---|---|
| PubChem CID | 155638266 |
| Molecular Formula | C28H30NSi+ |
| Molecular Weight | 408.64 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | 2-methyl-1-(2-methyl-5-phenylphenyl)-6-(1-methylsilolan-1-yl)isoquinolin-2-ium |
| SMILES | Cc1ccc(-c2ccccc2)cc1-c1c2ccc([Si]3(C)CCCC3)cc2cc[n+]1C |
| InChI | InChI=1S/C28H30NSi/c1-21-11-12-23(22-9-5-4-6-10-22)20-27(21)28-26-14-13-25(30(3)17-7-8-18-30)19-24(26)15-16-29(28)2/h4-6,9-16,19-20H,7-8,17-18H2,1-3H3/q+1 |
| InChIKey | JOOFVOPGGGOXKI-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.64 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|