C30H34N+ — CID 158983106
6-tert-butyl-4-deuterio-1-[4-(2,6-dimethylphenyl)-2-methylphenyl]-2,3-dimethylisoquinolin-2-ium (PubChem CID 158983106) has the molecular formula C30H34N+ and a molecular weight of 409.62 g/mol. Its IUPAC name is 6-tert-butyl-4-deuterio-1-[4-(2,6-dimethylphenyl)-2-methylphenyl]-2,3-dimethylisoquinolin-2-ium.
| Compound Name | 6-tert-butyl-4-deuterio-1-[4-(2,6-dimethylphenyl)-2-methylphenyl]-2,3-dimethylisoquinolin-2-ium |
|---|---|
| PubChem CID | 158983106 |
| Molecular Formula | C30H34N+ |
| Molecular Weight | 409.62 g/mol |
| Exact Mass | 409.27 |
| IUPAC Name | 6-tert-butyl-4-deuterio-1-[4-(2,6-dimethylphenyl)-2-methylphenyl]-2,3-dimethylisoquinolin-2-ium |
| SMILES | [2H]c1c(C)[n+](C)c(-c2ccc(-c3c(C)cccc3C)cc2C)c2ccc(C(C)(C)C)cc12 |
| InChI | InChI=1S/C30H34N/c1-19-10-9-11-20(2)28(19)23-12-14-26(21(3)16-23)29-27-15-13-25(30(5,6)7)18-24(27)17-22(4)31(29)8/h9-18H,1-8H3/q+1/i17D |
| InChIKey | XPUDFXYWWGIRBT-OKWSDYJOSA-N |
| XLogP | 7.53 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.62 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|