C29H40N+ — CID 155639410
6-tert-butyl-3-deuterio-1-(3,5-ditert-butyl-2-methylphenyl)-2-methylisoquinolin-2-ium (PubChem CID 155639410) has the molecular formula C29H40N+ and a molecular weight of 403.65 g/mol. Its IUPAC name is 6-tert-butyl-3-deuterio-1-(3,5-ditert-butyl-2-methylphenyl)-2-methylisoquinolin-2-ium.
| Compound Name | 6-tert-butyl-3-deuterio-1-(3,5-ditert-butyl-2-methylphenyl)-2-methylisoquinolin-2-ium |
|---|---|
| PubChem CID | 155639410 |
| Molecular Formula | C29H40N+ |
| Molecular Weight | 403.65 g/mol |
| Exact Mass | 403.32 |
| IUPAC Name | 6-tert-butyl-3-deuterio-1-(3,5-ditert-butyl-2-methylphenyl)-2-methylisoquinolin-2-ium |
| SMILES | [2H]c1cc2cc(C(C)(C)C)ccc2c(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2C)[n+]1C |
| InChI | InChI=1S/C29H40N/c1-19-24(17-22(28(5,6)7)18-25(19)29(8,9)10)26-23-13-12-21(27(2,3)4)16-20(23)14-15-30(26)11/h12-18H,1-11H3/q+1/i15D |
| InChIKey | VTASBYNVXJMQNN-RWFJLFJASA-N |
| XLogP | 7.53 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.65 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|