C33H50NSi+ — CID 155637945
tert-butyl-[1-(3,5-ditert-butyl-2-methylphenyl)-2-methylisoquinolin-2-ium-6-yl]-diethylsilane (PubChem CID 155637945) has the molecular formula C33H50NSi+ and a molecular weight of 488.86 g/mol. Its IUPAC name is tert-butyl-[1-(3,5-ditert-butyl-2-methylphenyl)-2-methylisoquinolin-2-ium-6-yl]-diethylsilane.
| Compound Name | tert-butyl-[1-(3,5-ditert-butyl-2-methylphenyl)-2-methylisoquinolin-2-ium-6-yl]-diethylsilane |
|---|---|
| PubChem CID | 155637945 |
| Molecular Formula | C33H50NSi+ |
| Molecular Weight | 488.86 g/mol |
| Exact Mass | 488.37 |
| IUPAC Name | tert-butyl-[1-(3,5-ditert-butyl-2-methylphenyl)-2-methylisoquinolin-2-ium-6-yl]-diethylsilane |
| SMILES | CC[Si](CC)(c1ccc2c(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3C)[n+](C)ccc2c1)C(C)(C)C |
| InChI | InChI=1S/C33H50NSi/c1-14-35(15-2,33(10,11)12)26-16-17-27-24(20-26)18-19-34(13)30(27)28-21-25(31(4,5)6)22-29(23(28)3)32(7,8)9/h16-22H,14-15H2,1-13H3/q+1 |
| InChIKey | BWBCNSKVNPDOMO-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.86 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|