C17H22N+ — CID 168843060
2-(2,5-dimethylphenyl)-1,3,5,6-tetramethylpyridin-1-ium (PubChem CID 168843060) has the molecular formula C17H22N+ and a molecular weight of 240.37 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)-1,3,5,6-tetramethylpyridin-1-ium.
| Compound Name | 2-(2,5-dimethylphenyl)-1,3,5,6-tetramethylpyridin-1-ium |
|---|---|
| PubChem CID | 168843060 |
| Molecular Formula | C17H22N+ |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 2-(2,5-dimethylphenyl)-1,3,5,6-tetramethylpyridin-1-ium |
| SMILES | Cc1ccc(C)c(-c2c(C)cc(C)c(C)[n+]2C)c1 |
| InChI | InChI=1S/C17H22N/c1-11-7-8-12(2)16(9-11)17-14(4)10-13(3)15(5)18(17)6/h7-10H,1-6H3/q+1 |
| InChIKey | ZMZJULXMEPDIPR-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|