C15H15F — CID 138652236
1-(2,5-dimethylphenyl)-2-fluoro-4-methylbenzene (PubChem CID 138652236) has the molecular formula C15H15F and a molecular weight of 214.28 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-2-fluoro-4-methylbenzene.
| Compound Name | 1-(2,5-dimethylphenyl)-2-fluoro-4-methylbenzene |
|---|---|
| PubChem CID | 138652236 |
| Molecular Formula | C15H15F |
| Molecular Weight | 214.28 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-2-fluoro-4-methylbenzene |
| SMILES | Cc1ccc(-c2cc(C)ccc2C)c(F)c1 |
| InChI | InChI=1S/C15H15F/c1-10-4-6-12(3)14(8-10)13-7-5-11(2)9-15(13)16/h4-9H,1-3H3 |
| InChIKey | RIVOGEQOZDOZAP-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.28 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |