C18H19N2+ — CID 159700127
4-deuterio-2,3,7-trimethyl-1-(3-methyl-4-pyridinyl)isoquinolin-2-ium (PubChem CID 159700127) has the molecular formula C18H19N2+ and a molecular weight of 264.37 g/mol. Its IUPAC name is 4-deuterio-2,3,7-trimethyl-1-(3-methyl-4-pyridinyl)isoquinolin-2-ium.
| Compound Name | 4-deuterio-2,3,7-trimethyl-1-(3-methyl-4-pyridinyl)isoquinolin-2-ium |
|---|---|
| PubChem CID | 159700127 |
| Molecular Formula | C18H19N2+ |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 4-deuterio-2,3,7-trimethyl-1-(3-methyl-4-pyridinyl)isoquinolin-2-ium |
| SMILES | [2H]c1c(C)[n+](C)c(-c2ccncc2C)c2cc(C)ccc12 |
| InChI | InChI=1S/C18H19N2/c1-12-5-6-15-10-14(3)20(4)18(17(15)9-12)16-7-8-19-11-13(16)2/h5-11H,1-4H3/q+1/i10D |
| InChIKey | HCULQBYZWPNRGM-MMIHMFRQSA-N |
| XLogP | 3.65 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|