C28H38N+ — CID 158978662
4-deuterio-6-(2,4-dimethylpentan-3-yl)-2,3,7-trimethyl-1-(2,3,5-trimethylphenyl)isoquinolin-2-ium (PubChem CID 158978662) has the molecular formula C28H38N+ and a molecular weight of 389.63 g/mol. Its IUPAC name is 4-deuterio-6-(2,4-dimethylpentan-3-yl)-2,3,7-trimethyl-1-(2,3,5-trimethylphenyl)isoquinolin-2-ium.
| Compound Name | 4-deuterio-6-(2,4-dimethylpentan-3-yl)-2,3,7-trimethyl-1-(2,3,5-trimethylphenyl)isoquinolin-2-ium |
|---|---|
| PubChem CID | 158978662 |
| Molecular Formula | C28H38N+ |
| Molecular Weight | 389.63 g/mol |
| Exact Mass | 389.31 |
| IUPAC Name | 4-deuterio-6-(2,4-dimethylpentan-3-yl)-2,3,7-trimethyl-1-(2,3,5-trimethylphenyl)isoquinolin-2-ium |
| SMILES | [2H]c1c(C)[n+](C)c(-c2cc(C)cc(C)c2C)c2cc(C)c(C(C(C)C)C(C)C)cc12 |
| InChI | InChI=1S/C28H38N/c1-16(2)27(17(3)4)24-15-23-14-21(8)29(10)28(26(23)13-20(24)7)25-12-18(5)11-19(6)22(25)9/h11-17,27H,1-10H3/q+1/i14D |
| InChIKey | HBESWOCUHNMAPQ-FCFVPJCTSA-N |
| XLogP | 7.27 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.63 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|