C17H24GeN+ — CID 166010923
trimethyl-[1-methyl-6-(2-methylphenyl)-2-(trideuteriomethyl)pyridin-1-ium-3-yl]germane (PubChem CID 166010923) has the molecular formula C17H24GeN+ and a molecular weight of 318.01 g/mol. Its IUPAC name is trimethyl-[1-methyl-6-(2-methylphenyl)-2-(trideuteriomethyl)pyridin-1-ium-3-yl]germane.
| Compound Name | trimethyl-[1-methyl-6-(2-methylphenyl)-2-(trideuteriomethyl)pyridin-1-ium-3-yl]germane |
|---|---|
| PubChem CID | 166010923 |
| Molecular Formula | C17H24GeN+ |
| Molecular Weight | 318.01 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | trimethyl-[1-methyl-6-(2-methylphenyl)-2-(trideuteriomethyl)pyridin-1-ium-3-yl]germane |
| SMILES | [2H]C([2H])([2H])c1c([Ge](C)(C)C)ccc(-c2ccccc2C)[n+]1C |
| InChI | InChI=1S/C17H24GeN/c1-13-9-7-8-10-15(13)17-12-11-16(18(3,4)5)14(2)19(17)6/h7-12H,1-6H3/q+1/i2D3 |
| InChIKey | ISFLCUAGQAPDSD-BMSJAHLVSA-N |
| XLogP | 3.34 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.01 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|