C20H28N+ — CID 164777922
1-methyl-2-(3-methylpentan-3-yl)-6-(2-methylphenyl)-3-(trideuteriomethyl)pyridin-1-ium (PubChem CID 164777922) has the molecular formula C20H28N+ and a molecular weight of 285.47 g/mol. Its IUPAC name is 1-methyl-2-(3-methylpentan-3-yl)-6-(2-methylphenyl)-3-(trideuteriomethyl)pyridin-1-ium.
| Compound Name | 1-methyl-2-(3-methylpentan-3-yl)-6-(2-methylphenyl)-3-(trideuteriomethyl)pyridin-1-ium |
|---|---|
| PubChem CID | 164777922 |
| Molecular Formula | C20H28N+ |
| Molecular Weight | 285.47 g/mol |
| Exact Mass | 285.24 |
| IUPAC Name | 1-methyl-2-(3-methylpentan-3-yl)-6-(2-methylphenyl)-3-(trideuteriomethyl)pyridin-1-ium |
| SMILES | [2H]C([2H])([2H])c1ccc(-c2ccccc2C)[n+](C)c1C(C)(CC)CC |
| InChI | InChI=1S/C20H28N/c1-7-20(5,8-2)19-16(4)13-14-18(21(19)6)17-12-10-9-11-15(17)3/h9-14H,7-8H2,1-6H3/q+1/i4D3 |
| InChIKey | QSJJVVJFAZXDKI-GKOSEXJESA-N |
| XLogP | 4.87 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.47 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|