C20H22N2+2 — CID 140944469
1-methyl-2-[1-methyl-6-(2-methylphenyl)pyridin-1-ium-2-yl]-4-(trideuteriomethyl)pyridin-1-ium (PubChem CID 140944469) has the molecular formula C20H22N2+2 and a molecular weight of 293.43 g/mol. Its IUPAC name is 1-methyl-2-[1-methyl-6-(2-methylphenyl)pyridin-1-ium-2-yl]-4-(trideuteriomethyl)pyridin-1-ium.
| Compound Name | 1-methyl-2-[1-methyl-6-(2-methylphenyl)pyridin-1-ium-2-yl]-4-(trideuteriomethyl)pyridin-1-ium |
|---|---|
| PubChem CID | 140944469 |
| Molecular Formula | C20H22N2+2 |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | 1-methyl-2-[1-methyl-6-(2-methylphenyl)pyridin-1-ium-2-yl]-4-(trideuteriomethyl)pyridin-1-ium |
| SMILES | [2H]C([2H])([2H])c1cc[n+](C)c(-c2cccc(-c3ccccc3C)[n+]2C)c1 |
| InChI | InChI=1S/C20H22N2/c1-15-12-13-21(3)20(14-15)19-11-7-10-18(22(19)4)17-9-6-5-8-16(17)2/h5-14H,1-4H3/q+2/i1D3 |
| InChIKey | CPGLMHPCALHJSZ-FIBGUPNXSA-N |
| XLogP | 3.29 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|