C16H13FN2O — CID 115049958
2-fluoro-5-(5-methyl-2-phenyl-1,3-oxazol-4-yl)aniline (PubChem CID 115049958) has the molecular formula C16H13FN2O and a molecular weight of 268.29 g/mol. Its IUPAC name is 2-fluoro-5-(5-methyl-2-phenyl-1,3-oxazol-4-yl)aniline.
| Compound Name | 2-fluoro-5-(5-methyl-2-phenyl-1,3-oxazol-4-yl)aniline |
|---|---|
| PubChem CID | 115049958 |
| Molecular Formula | C16H13FN2O |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 2-fluoro-5-(5-methyl-2-phenyl-1,3-oxazol-4-yl)aniline |
| SMILES | Cc1oc(-c2ccccc2)nc1-c1ccc(F)c(N)c1 |
| InChI | InChI=1S/C16H13FN2O/c1-10-15(12-7-8-13(17)14(18)9-12)19-16(20-10)11-5-3-2-4-6-11/h2-9H,18H2,1H3 |
| InChIKey | VRTQLRFZTBMJQK-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|