C22H19N2O+ — CID 11596633
4-(1-benzylpyridin-1-ium-4-yl)-5-methyl-2-phenyl-1,3-oxazole (PubChem CID 11596633) has the molecular formula C22H19N2O+ and a molecular weight of 327.41 g/mol. Its IUPAC name is 4-(1-benzylpyridin-1-ium-4-yl)-5-methyl-2-phenyl-1,3-oxazole.
| Compound Name | 4-(1-benzylpyridin-1-ium-4-yl)-5-methyl-2-phenyl-1,3-oxazole |
|---|---|
| PubChem CID | 11596633 |
| Molecular Formula | C22H19N2O+ |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 4-(1-benzylpyridin-1-ium-4-yl)-5-methyl-2-phenyl-1,3-oxazole |
| SMILES | Cc1oc(-c2ccccc2)nc1-c1cc[n+](Cc2ccccc2)cc1 |
| InChI | InChI=1S/C22H19N2O/c1-17-21(23-22(25-17)20-10-6-3-7-11-20)19-12-14-24(15-13-19)16-18-8-4-2-5-9-18/h2-15H,16H2,1H3/q+1 |
| InChIKey | BITUFSSQGHZPGF-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|