C12H22NO6P — CID 101128944
N-[(1R,2R,6S)-4-diethoxyphosphoryl-2,6-dihydroxycyclohex-3-en-1-yl]acetamide (PubChem CID 101128944) has the molecular formula C12H22NO6P and a molecular weight of 307.28 g/mol. Its IUPAC name is N-[(1R,2R,6S)-4-diethoxyphosphoryl-2,6-dihydroxycyclohex-3-en-1-yl]acetamide.
| Compound Name | N-[(1R,2R,6S)-4-diethoxyphosphoryl-2,6-dihydroxycyclohex-3-en-1-yl]acetamide |
|---|---|
| PubChem CID | 101128944 |
| Molecular Formula | C12H22NO6P |
| Molecular Weight | 307.28 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | N-[(1R,2R,6S)-4-diethoxyphosphoryl-2,6-dihydroxycyclohex-3-en-1-yl]acetamide |
| SMILES | CCOP(=O)(OCC)C1=C[C@@H](O)[C@H](NC(C)=O)[C@@H](O)C1 |
| InChI | InChI=1S/C12H22NO6P/c1-4-18-20(17,19-5-2)9-6-10(15)12(11(16)7-9)13-8(3)14/h6,10-12,15-16H,4-5,7H2,1-3H3,(H,13,14)/t10-,11+,12+/m1/s1 |
| InChIKey | GZDVBCGVRLAXBL-WOPDTQHZSA-N |
| XLogP | 0.77 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.28 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|