C13H22BrNO3 — CID 91077590
N-(4-bromo-6-hydroxy-2-pentan-3-yloxycyclohex-3-en-1-yl)acetamide (PubChem CID 91077590) has the molecular formula C13H22BrNO3 and a molecular weight of 320.23 g/mol. Its IUPAC name is N-(4-bromo-6-hydroxy-2-pentan-3-yloxycyclohex-3-en-1-yl)acetamide.
| Compound Name | N-(4-bromo-6-hydroxy-2-pentan-3-yloxycyclohex-3-en-1-yl)acetamide |
|---|---|
| PubChem CID | 91077590 |
| Molecular Formula | C13H22BrNO3 |
| Molecular Weight | 320.23 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | N-(4-bromo-6-hydroxy-2-pentan-3-yloxycyclohex-3-en-1-yl)acetamide |
| SMILES | CCC(CC)OC1C=C(Br)CC(O)C1NC(C)=O |
| InChI | InChI=1S/C13H22BrNO3/c1-4-10(5-2)18-12-7-9(14)6-11(17)13(12)15-8(3)16/h7,10-13,17H,4-6H2,1-3H3,(H,15,16) |
| InChIKey | HHSFFVVWQODKOC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.23 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |