C18H30N2O5 — CID 146156596
ethyl 4,5-diacetamido-3-pentan-3-yloxycyclohexene-1-carboxylate (PubChem CID 146156596) has the molecular formula C18H30N2O5 and a molecular weight of 354.45 g/mol. Its IUPAC name is ethyl 4,5-diacetamido-3-pentan-3-yloxycyclohexene-1-carboxylate.
| Compound Name | ethyl 4,5-diacetamido-3-pentan-3-yloxycyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 146156596 |
| Molecular Formula | C18H30N2O5 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | ethyl 4,5-diacetamido-3-pentan-3-yloxycyclohexene-1-carboxylate |
| SMILES | CCOC(=O)C1=CC(OC(CC)CC)C(NC(C)=O)C(NC(C)=O)C1 |
| InChI | InChI=1S/C18H30N2O5/c1-6-14(7-2)25-16-10-13(18(23)24-8-3)9-15(19-11(4)21)17(16)20-12(5)22/h10,14-17H,6-9H2,1-5H3,(H,19,21)(H,20,22) |
| InChIKey | IWASCEKXRLUKKH-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |