C18H34N3O9P — CID 46201074
ethyl (3R,4R,5S)-4-acetamido-5-[(2-aminoacetyl)amino]-3-pentan-3-yloxycyclohexene-1-carboxylate;phosphoric acid (PubChem CID 46201074) has the molecular formula C18H34N3O9P and a molecular weight of 467.46 g/mol. Its IUPAC name is ethyl (3R,4R,5S)-4-acetamido-5-[(2-aminoacetyl)amino]-3-pentan-3-yloxycyclohexene-1-carboxylate;phosphoric acid.
| Compound Name | ethyl (3R,4R,5S)-4-acetamido-5-[(2-aminoacetyl)amino]-3-pentan-3-yloxycyclohexene-1-carboxylate;phosphoric acid |
|---|---|
| PubChem CID | 46201074 |
| Molecular Formula | C18H34N3O9P |
| Molecular Weight | 467.46 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | ethyl (3R,4R,5S)-4-acetamido-5-[(2-aminoacetyl)amino]-3-pentan-3-yloxycyclohexene-1-carboxylate;phosphoric acid |
| SMILES | CCOC(=O)C1=C[C@@H](OC(CC)CC)[C@H](NC(C)=O)[C@@H](NC(=O)CN)C1.O=P(O)(O)O |
| InChI | InChI=1S/C18H31N3O5.H3O4P/c1-5-13(6-2)26-15-9-12(18(24)25-7-3)8-14(21-16(23)10-19)17(15)20-11(4)22;1-5(2,3)4/h9,13-15,17H,5-8,10,19H2,1-4H3,(H,20,22)(H,21,23);(H3,1,2,3,4)/t14-,15+,17+;/m0./s1 |
| InChIKey | GSCLPOCCJSLHPK-FFMLRVAQSA-N |
| XLogP | -0.53 |
| TPSA | 197.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.46 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|