C21H37N3O4S — CID 162644157
(3R,4R,5S)-4-acetamido-5-[di(propan-2-yl)carbamothioylamino]-3-pentan-3-yloxycyclohexene-1-carboxylic acid (PubChem CID 162644157) has the molecular formula C21H37N3O4S and a molecular weight of 427.61 g/mol. Its IUPAC name is (3R,4R,5S)-4-acetamido-5-[di(propan-2-yl)carbamothioylamino]-3-pentan-3-yloxycyclohexene-1-carboxylic acid.
| Compound Name | (3R,4R,5S)-4-acetamido-5-[di(propan-2-yl)carbamothioylamino]-3-pentan-3-yloxycyclohexene-1-carboxylic acid |
|---|---|
| PubChem CID | 162644157 |
| Molecular Formula | C21H37N3O4S |
| Molecular Weight | 427.61 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | (3R,4R,5S)-4-acetamido-5-[di(propan-2-yl)carbamothioylamino]-3-pentan-3-yloxycyclohexene-1-carboxylic acid |
| SMILES | CCC(CC)O[C@@H]1C=C(C(=O)O)C[C@H](NC(=S)N(C(C)C)C(C)C)[C@H]1NC(C)=O |
| InChI | InChI=1S/C21H37N3O4S/c1-8-16(9-2)28-18-11-15(20(26)27)10-17(19(18)22-14(7)25)23-21(29)24(12(3)4)13(5)6/h11-13,16-19H,8-10H2,1-7H3,(H,22,25)(H,23,29)(H,26,27)/t17-,18+,19+/m0/s1 |
| InChIKey | WCOQKRNKMIIRGB-IPMKNSEASA-N |
| XLogP | 2.84 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.61 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|