C19H34N4O5 — CID 164616658
(3R,4R,5S)-4-acetamido-5-[(2-methylpropylamino)carbamoylamino]-3-pentan-3-yloxycyclohexene-1-carboxylic acid (PubChem CID 164616658) has the molecular formula C19H34N4O5 and a molecular weight of 398.50 g/mol. Its IUPAC name is (3R,4R,5S)-4-acetamido-5-[(2-methylpropylamino)carbamoylamino]-3-pentan-3-yloxycyclohexene-1-carboxylic acid.
| Compound Name | (3R,4R,5S)-4-acetamido-5-[(2-methylpropylamino)carbamoylamino]-3-pentan-3-yloxycyclohexene-1-carboxylic acid |
|---|---|
| PubChem CID | 164616658 |
| Molecular Formula | C19H34N4O5 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | (3R,4R,5S)-4-acetamido-5-[(2-methylpropylamino)carbamoylamino]-3-pentan-3-yloxycyclohexene-1-carboxylic acid |
| SMILES | CCC(CC)O[C@@H]1C=C(C(=O)O)C[C@H](NC(=O)NNCC(C)C)[C@H]1NC(C)=O |
| InChI | InChI=1S/C19H34N4O5/c1-6-14(7-2)28-16-9-13(18(25)26)8-15(17(16)21-12(5)24)22-19(27)23-20-10-11(3)4/h9,11,14-17,20H,6-8,10H2,1-5H3,(H,21,24)(H,25,26)(H2,22,23,27)/t15-,16+,17+/m0/s1 |
| InChIKey | JCMANAXHMPZQBG-GVDBMIGSSA-N |
| XLogP | 1.31 |
| TPSA | 128.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|