C22H31ClN4O5 — CID 164620835
(3R,4R,5S)-4-acetamido-5-[[(3-chlorophenyl)methylamino]carbamoylamino]-3-pentan-3-yloxycyclohexene-1-carboxylic acid (PubChem CID 164620835) has the molecular formula C22H31ClN4O5 and a molecular weight of 466.97 g/mol. Its IUPAC name is (3R,4R,5S)-4-acetamido-5-[[(3-chlorophenyl)methylamino]carbamoylamino]-3-pentan-3-yloxycyclohexene-1-carboxylic acid.
| Compound Name | (3R,4R,5S)-4-acetamido-5-[[(3-chlorophenyl)methylamino]carbamoylamino]-3-pentan-3-yloxycyclohexene-1-carboxylic acid |
|---|---|
| PubChem CID | 164620835 |
| Molecular Formula | C22H31ClN4O5 |
| Molecular Weight | 466.97 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | (3R,4R,5S)-4-acetamido-5-[[(3-chlorophenyl)methylamino]carbamoylamino]-3-pentan-3-yloxycyclohexene-1-carboxylic acid |
| SMILES | CCC(CC)O[C@@H]1C=C(C(=O)O)C[C@H](NC(=O)NNCc2cccc(Cl)c2)[C@H]1NC(C)=O |
| InChI | InChI=1S/C22H31ClN4O5/c1-4-17(5-2)32-19-11-15(21(29)30)10-18(20(19)25-13(3)28)26-22(31)27-24-12-14-7-6-8-16(23)9-14/h6-9,11,17-20,24H,4-5,10,12H2,1-3H3,(H,25,28)(H,29,30)(H2,26,27,31)/t18-,19+,20+/m0/s1 |
| InChIKey | DDRQALGMWGPBNZ-XUVXKRRUSA-N |
| XLogP | 2.51 |
| TPSA | 128.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.97 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|