C21H38N4O4 — CID 118716492
(3R,4R,5S)-4-acetamido-5-[carbamimidoyl(2-ethylbutyl)amino]-3-pentan-3-yloxycyclohexene-1-carboxylic acid (PubChem CID 118716492) has the molecular formula C21H38N4O4 and a molecular weight of 410.56 g/mol. Its IUPAC name is (3R,4R,5S)-4-acetamido-5-[carbamimidoyl(2-ethylbutyl)amino]-3-pentan-3-yloxycyclohexene-1-carboxylic acid.
| Compound Name | (3R,4R,5S)-4-acetamido-5-[carbamimidoyl(2-ethylbutyl)amino]-3-pentan-3-yloxycyclohexene-1-carboxylic acid |
|---|---|
| PubChem CID | 118716492 |
| Molecular Formula | C21H38N4O4 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.29 |
| IUPAC Name | (3R,4R,5S)-4-acetamido-5-[carbamimidoyl(2-ethylbutyl)amino]-3-pentan-3-yloxycyclohexene-1-carboxylic acid |
| SMILES | [H]/N=C(\N)N(CC(CC)CC)[C@H]1CC(C(=O)O)=C[C@@H](OC(CC)CC)[C@@H]1NC(C)=O |
| InChI | InChI=1S/C21H38N4O4/c1-6-14(7-2)12-25(21(22)23)17-10-15(20(27)28)11-18(19(17)24-13(5)26)29-16(8-3)9-4/h11,14,16-19H,6-10,12H2,1-5H3,(H3,22,23)(H,24,26)(H,27,28)/t17-,18+,19+/m0/s1 |
| InChIKey | YZOJCRLYJDNFSE-IPMKNSEASA-N |
| XLogP | 2.48 |
| TPSA | 128.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|