C15H23ClN2O4 — CID 78135175
5-amino-4-(3-chloroprop-2-enoylamino)-3-pentan-3-yloxycyclohexene-1-carboxylic acid (PubChem CID 78135175) has the molecular formula C15H23ClN2O4 and a molecular weight of 330.81 g/mol. Its IUPAC name is 5-amino-4-(3-chloroprop-2-enoylamino)-3-pentan-3-yloxycyclohexene-1-carboxylic acid.
| Compound Name | 5-amino-4-(3-chloroprop-2-enoylamino)-3-pentan-3-yloxycyclohexene-1-carboxylic acid |
|---|---|
| PubChem CID | 78135175 |
| Molecular Formula | C15H23ClN2O4 |
| Molecular Weight | 330.81 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 5-amino-4-(3-chloroprop-2-enoylamino)-3-pentan-3-yloxycyclohexene-1-carboxylic acid |
| SMILES | CCC(CC)OC1C=C(C(=O)O)CC(N)C1NC(=O)C=CCl |
| InChI | InChI=1S/C15H23ClN2O4/c1-3-10(4-2)22-12-8-9(15(20)21)7-11(17)14(12)18-13(19)5-6-16/h5-6,8,10-12,14H,3-4,7,17H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | WUVYNOGPZSSXFO-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.81 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|