C24H32N2O2 — CID 175804583
N-[(1R,2R,6S)-6-(naphthalen-1-ylmethylamino)-2-pentan-3-yloxycyclohex-3-en-1-yl]acetamide (PubChem CID 175804583) has the molecular formula C24H32N2O2 and a molecular weight of 380.53 g/mol. Its IUPAC name is N-[(1R,2R,6S)-6-(naphthalen-1-ylmethylamino)-2-pentan-3-yloxycyclohex-3-en-1-yl]acetamide.
| Compound Name | N-[(1R,2R,6S)-6-(naphthalen-1-ylmethylamino)-2-pentan-3-yloxycyclohex-3-en-1-yl]acetamide |
|---|---|
| PubChem CID | 175804583 |
| Molecular Formula | C24H32N2O2 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | N-[(1R,2R,6S)-6-(naphthalen-1-ylmethylamino)-2-pentan-3-yloxycyclohex-3-en-1-yl]acetamide |
| SMILES | CCC(CC)O[C@@H]1C=CC[C@H](NCc2cccc3ccccc23)[C@H]1NC(C)=O |
| InChI | InChI=1S/C24H32N2O2/c1-4-20(5-2)28-23-15-9-14-22(24(23)26-17(3)27)25-16-19-12-8-11-18-10-6-7-13-21(18)19/h6-13,15,20,22-25H,4-5,14,16H2,1-3H3,(H,26,27)/t22-,23+,24+/m0/s1 |
| InChIKey | TXDPAUTZLQRIRS-RBZQAINGSA-N |
| XLogP | 4.34 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|