C24H36N3O5P — CID 90643659
[(3R,4R,5S)-4-acetamido-5-amino-3-pentan-3-yloxycyclohexen-1-yl]-[3-(1H-indol-3-yl)propoxy]phosphinic acid (PubChem CID 90643659) has the molecular formula C24H36N3O5P and a molecular weight of 477.54 g/mol. Its IUPAC name is [(3R,4R,5S)-4-acetamido-5-amino-3-pentan-3-yloxycyclohexen-1-yl]-[3-(1H-indol-3-yl)propoxy]phosphinic acid.
| Compound Name | [(3R,4R,5S)-4-acetamido-5-amino-3-pentan-3-yloxycyclohexen-1-yl]-[3-(1H-indol-3-yl)propoxy]phosphinic acid |
|---|---|
| PubChem CID | 90643659 |
| Molecular Formula | C24H36N3O5P |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | [(3R,4R,5S)-4-acetamido-5-amino-3-pentan-3-yloxycyclohexen-1-yl]-[3-(1H-indol-3-yl)propoxy]phosphinic acid |
| SMILES | CCC(CC)O[C@@H]1C=C(P(=O)(O)OCCCc2c[nH]c3ccccc23)C[C@H](N)[C@H]1NC(C)=O |
| InChI | InChI=1S/C24H36N3O5P/c1-4-18(5-2)32-23-14-19(13-21(25)24(23)27-16(3)28)33(29,30)31-12-8-9-17-15-26-22-11-7-6-10-20(17)22/h6-7,10-11,14-15,18,21,23-24,26H,4-5,8-9,12-13,25H2,1-3H3,(H,27,28)(H,29,30)/t21-,23+,24+/m0/s1 |
| InChIKey | XZTGIIRJMIIWHN-QPTUXGOLSA-N |
| XLogP | 4.00 |
| TPSA | 126.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|