C21H35NO6P2 — CID 102336259
7,7-bis(diethoxyphosphoryl)-5-phenyl-1,2,3,5,6,8-hexahydropyrrolizine (PubChem CID 102336259) has the molecular formula C21H35NO6P2 and a molecular weight of 459.46 g/mol. Its IUPAC name is 7,7-bis(diethoxyphosphoryl)-5-phenyl-1,2,3,5,6,8-hexahydropyrrolizine.
| Compound Name | 7,7-bis(diethoxyphosphoryl)-5-phenyl-1,2,3,5,6,8-hexahydropyrrolizine |
|---|---|
| PubChem CID | 102336259 |
| Molecular Formula | C21H35NO6P2 |
| Molecular Weight | 459.46 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | 7,7-bis(diethoxyphosphoryl)-5-phenyl-1,2,3,5,6,8-hexahydropyrrolizine |
| SMILES | CCOP(=O)(OCC)C1(P(=O)(OCC)OCC)CC(c2ccccc2)N2CCCC21 |
| InChI | InChI=1S/C21H35NO6P2/c1-5-25-29(23,26-6-2)21(30(24,27-7-3)28-8-4)17-19(18-13-10-9-11-14-18)22-16-12-15-20(21)22/h9-11,13-14,19-20H,5-8,12,15-17H2,1-4H3 |
| InChIKey | UCCXTDWVSOZRKV-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.46 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|